About 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid
4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid (PubChem CID 19752781) has the molecular formula C21H21Cl3N2O4
and a molecular weight of 471.77 g/mol. Its IUPAC name is 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid |
| PubChem CID | 19752781 |
| Molecular Formula | C21H21Cl3N2O4 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid |
| SMILES | CCC(C)N(C(=O)c1cc(Cl)c(Cl)c(Cl)c1)N(CC)C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H21Cl3N2O4/c1-4-12(3)26(20(28)15-10-16(22)18(24)17(23)11-15)25(5-2)19(27)13-6-8-14(9-7-13)21(29)30/h6-12H,4-5H2,1-3H3,(H,29,30) |
| InChIKey | PHZPOPLZHWSIDP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid?
The IUPAC name of 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid (CID 19752781) is 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid.
What is the SMILES notation for 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid?
The canonical SMILES for 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid is CCC(C)N(C(=O)c1cc(Cl)c(Cl)c(Cl)c1)N(CC)C(=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid?
The InChIKey is PHZPOPLZHWSIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl3N2O4/c1-4-12(3)26(20(28)15-10-16(22)18(24)17(23)11-15)25(5-2)19(27)13-6-8-14(9-7-13)21(29)30/h6-12H,4-5H2,1-3H3,(H,29,30).
What are the key properties of 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid?
4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid has a molecular weight of 471.77 g/mol, XLogP of 5.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[butan-2-yl-(3,4,5-trichlorobenzoyl)amino]-ethylcarbamoyl]benzoic acid is sourced from PubChem (CID 19752781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).