About N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide
N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide (PubChem CID 19752997) has the molecular formula C21H23F3N2O2
and a molecular weight of 392.42 g/mol. Its IUPAC name is N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide.
Molecular Properties
| Compound Name | N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide |
| PubChem CID | 19752997 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide |
| SMILES | CCN(C(=O)c1ccccc1)N(C(=O)c1ccc(C(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C21H23F3N2O2/c1-5-25(18(27)15-9-7-6-8-10-15)26(20(2,3)4)19(28)16-11-13-17(14-12-16)21(22,23)24/h6-14H,5H2,1-4H3 |
| InChIKey | OCPCKMUXIRTZPC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide?
The IUPAC name of N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide (CID 19752997) is N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide.
What is the SMILES notation for N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide?
The canonical SMILES for N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide is CCN(C(=O)c1ccccc1)N(C(=O)c1ccc(C(F)(F)F)cc1)C(C)(C)C.
What is the InChIKey of N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide?
The InChIKey is OCPCKMUXIRTZPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F3N2O2/c1-5-25(18(27)15-9-7-6-8-10-15)26(20(2,3)4)19(28)16-11-13-17(14-12-16)21(22,23)24/h6-14H,5H2,1-4H3.
What are the key properties of N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide?
N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide has a molecular weight of 392.42 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzoyl-N-tert-butyl-N'-ethyl-4-(trifluoromethyl)benzohydrazide is sourced from PubChem (CID 19752997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).