About trimethoxy(1,1,2-trifluoropropyl)silane
trimethoxy(1,1,2-trifluoropropyl)silane (PubChem CID 19753086) has the molecular formula C6H13F3O3Si
and a molecular weight of 218.25 g/mol. Its IUPAC name is trimethoxy(1,1,2-trifluoropropyl)silane.
Molecular Properties
| Compound Name | trimethoxy(1,1,2-trifluoropropyl)silane |
| PubChem CID | 19753086 |
| Molecular Formula | C6H13F3O3Si |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | trimethoxy(1,1,2-trifluoropropyl)silane |
| SMILES | CO[Si](OC)(OC)C(F)(F)C(C)F |
| InChI | InChI=1S/C6H13F3O3Si/c1-5(7)6(8,9)13(10-2,11-3)12-4/h5H,1-4H3 |
| InChIKey | RZQYSPOOOKIOPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(1,1,2-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(1,1,2-trifluoropropyl)silane?
The IUPAC name of trimethoxy(1,1,2-trifluoropropyl)silane (CID 19753086) is trimethoxy(1,1,2-trifluoropropyl)silane.
What is the SMILES notation for trimethoxy(1,1,2-trifluoropropyl)silane?
The canonical SMILES for trimethoxy(1,1,2-trifluoropropyl)silane is CO[Si](OC)(OC)C(F)(F)C(C)F.
What is the InChIKey of trimethoxy(1,1,2-trifluoropropyl)silane?
The InChIKey is RZQYSPOOOKIOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3O3Si/c1-5(7)6(8,9)13(10-2,11-3)12-4/h5H,1-4H3.
What are the key properties of trimethoxy(1,1,2-trifluoropropyl)silane?
trimethoxy(1,1,2-trifluoropropyl)silane has a molecular weight of 218.25 g/mol, XLogP of 1.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(1,1,2-trifluoropropyl)silane is sourced from PubChem (CID 19753086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).