C20H38O3Si — CID 19753167
trimethyl-[[5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methoxy]silane (PubChem CID 19753167) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is trimethyl-[[5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methoxy]silane.
| Compound Name | trimethyl-[[5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 19753167 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | trimethyl-[[5-methyl-6-[2-(2,5,5-trimethyl-1,3-dioxan-2-yl)ethyl]cyclohexen-1-yl]methoxy]silane |
| SMILES | CC1CCC=C(CO[Si](C)(C)C)C1CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C20H38O3Si/c1-16-9-8-10-17(13-23-24(5,6)7)18(16)11-12-20(4)21-14-19(2,3)15-22-20/h10,16,18H,8-9,11-15H2,1-7H3 |
| InChIKey | GRRSKYAZLRIVGL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|