C17H16O5 — CID 19753340
2,3,4-trihydroxy-1,5-diphenylpentane-1,5-dione (PubChem CID 19753340) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,3,4-trihydroxy-1,5-diphenylpentane-1,5-dione.
| Compound Name | 2,3,4-trihydroxy-1,5-diphenylpentane-1,5-dione |
|---|---|
| PubChem CID | 19753340 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2,3,4-trihydroxy-1,5-diphenylpentane-1,5-dione |
| SMILES | O=C(c1ccccc1)C(O)C(O)C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O5/c18-13(11-7-3-1-4-8-11)15(20)17(22)16(21)14(19)12-9-5-2-6-10-12/h1-10,15-17,20-22H |
| InChIKey | VELQEDMHXJTXQI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |