C16H13F6NO4 — CID 19753530
1,1,1-trifluoro-3-[(6-phenoxy-2-pyridinyl)methoxy]-2-(trifluoromethoxy)propan-2-ol (PubChem CID 19753530) has the molecular formula C16H13F6NO4 and a molecular weight of 397.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(6-phenoxy-2-pyridinyl)methoxy]-2-(trifluoromethoxy)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[(6-phenoxy-2-pyridinyl)methoxy]-2-(trifluoromethoxy)propan-2-ol |
|---|---|
| PubChem CID | 19753530 |
| Molecular Formula | C16H13F6NO4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1,1,1-trifluoro-3-[(6-phenoxy-2-pyridinyl)methoxy]-2-(trifluoromethoxy)propan-2-ol |
| SMILES | OC(COCc1cccc(Oc2ccccc2)n1)(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H13F6NO4/c17-15(18,19)14(24,27-16(20,21)22)10-25-9-11-5-4-8-13(23-11)26-12-6-2-1-3-7-12/h1-8,24H,9-10H2 |
| InChIKey | PLDYNXRHEBQIFV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|