C18H18FN3OS — CID 19753547
[5-fluoro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]-(3H-1,2-thiazol-2-yl)methanone (PubChem CID 19753547) has the molecular formula C18H18FN3OS and a molecular weight of 343.43 g/mol. Its IUPAC name is [5-fluoro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]-(3H-1,2-thiazol-2-yl)methanone.
| Compound Name | [5-fluoro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]-(3H-1,2-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 19753547 |
| Molecular Formula | C18H18FN3OS |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [5-fluoro-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)indol-1-yl]-(3H-1,2-thiazol-2-yl)methanone |
| SMILES | CN1CC=C(c2cn(C(=O)N3CC=CS3)c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C18H18FN3OS/c1-20-8-5-13(6-9-20)16-12-21(18(23)22-7-2-10-24-22)17-4-3-14(19)11-15(16)17/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | YFIYXMBFRHNALN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|