About 1-bromo-1-ethoxyhexane
1-bromo-1-ethoxyhexane (PubChem CID 19753610) has the molecular formula C8H17BrO
and a molecular weight of 209.13 g/mol. Its IUPAC name is 1-bromo-1-ethoxyhexane.
Molecular Properties
| Compound Name | 1-bromo-1-ethoxyhexane |
| PubChem CID | 19753610 |
| Molecular Formula | C8H17BrO |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-bromo-1-ethoxyhexane |
| SMILES | CCCCCC(Br)OCC |
| InChI | InChI=1S/C8H17BrO/c1-3-5-6-7-8(9)10-4-2/h8H,3-7H2,1-2H3 |
| InChIKey | YIQDJBQJYMONCA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1-ethoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1-ethoxyhexane?
The IUPAC name of 1-bromo-1-ethoxyhexane (CID 19753610) is 1-bromo-1-ethoxyhexane.
What is the SMILES notation for 1-bromo-1-ethoxyhexane?
The canonical SMILES for 1-bromo-1-ethoxyhexane is CCCCCC(Br)OCC.
What is the InChIKey of 1-bromo-1-ethoxyhexane?
The InChIKey is YIQDJBQJYMONCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrO/c1-3-5-6-7-8(9)10-4-2/h8H,3-7H2,1-2H3.
What are the key properties of 1-bromo-1-ethoxyhexane?
1-bromo-1-ethoxyhexane has a molecular weight of 209.13 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1-ethoxyhexane is sourced from PubChem (CID 19753610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).