C18H22N2O6 — CID 19753824
2-[2-(3-methyl-2-oxobutanoyl)pyrazolidine-1-carbonyl]oxy-3-phenylpropanoic acid (PubChem CID 19753824) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[2-(3-methyl-2-oxobutanoyl)pyrazolidine-1-carbonyl]oxy-3-phenylpropanoic acid.
| Compound Name | 2-[2-(3-methyl-2-oxobutanoyl)pyrazolidine-1-carbonyl]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19753824 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[2-(3-methyl-2-oxobutanoyl)pyrazolidine-1-carbonyl]oxy-3-phenylpropanoic acid |
| SMILES | CC(C)C(=O)C(=O)N1CCCN1C(=O)OC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H22N2O6/c1-12(2)15(21)16(22)19-9-6-10-20(19)18(25)26-14(17(23)24)11-13-7-4-3-5-8-13/h3-5,7-8,12,14H,6,9-11H2,1-2H3,(H,23,24) |
| InChIKey | VXZWIEVATXFVTK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|