C64H116N6O8 — CID 19754028
1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,4,4-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid (PubChem CID 19754028) has the molecular formula C64H116N6O8 and a molecular weight of 1097.67 g/mol. Its IUPAC name is 1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,4,4-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,4,4-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 19754028 |
| Molecular Formula | C64H116N6O8 |
| Molecular Weight | 1097.67 g/mol |
| Exact Mass | 1096.89 |
| IUPAC Name | 1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,3,4,4-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid |
| SMILES | CN1C(C)(C)CC(C(C(=O)O)(C2CC(C)(C)N(C)C(C)(C)C2)C(C(=O)O)(C2CC(C)(C)NC(C)(C)C2)C(C(=O)O)(C2CC(C)(C)NC(C)(C)C2)C(C(=O)O)(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C64H116N6O8/c1-49(2)27-39(28-50(3,4)65-49)61(45(71)72,40-29-51(5,6)66-52(7,8)30-40)63(47(75)76,43-31-53(9,10)67-54(11,12)32-43)64(48(77)78,44-33-55(13,14)68-56(15,16)34-44)62(46(73)74,41-35-57(17,18)69(25)58(19,20)36-41)42-37-59(21,22)70(26)60(23,24)38-42/h39-44,65-68H,27-38H2,1-26H3,(H,71,72)(H,73,74)(H,75,76)(H,77,78) |
| InChIKey | MIOKEOHEWOLXDI-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 203.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.67 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |