C32H40N6O4S — CID 19754062
N-[3-[[4-[2-(butylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-7-methyl-2-propylimidazo[4,5-b]pyridin-6-yl]butanamide (PubChem CID 19754062) has the molecular formula C32H40N6O4S and a molecular weight of 604.78 g/mol. Its IUPAC name is N-[3-[[4-[2-(butylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-7-methyl-2-propylimidazo[4,5-b]pyridin-6-yl]butanamide.
| Compound Name | N-[3-[[4-[2-(butylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-7-methyl-2-propylimidazo[4,5-b]pyridin-6-yl]butanamide |
|---|---|
| PubChem CID | 19754062 |
| Molecular Formula | C32H40N6O4S |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | N-[3-[[4-[2-(butylcarbamoylsulfamoyl)phenyl]phenyl]methyl]-7-methyl-2-propylimidazo[4,5-b]pyridin-6-yl]butanamide |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccccc1-c1ccc(Cn2c(CCC)nc3c(C)c(NC(=O)CCC)cnc32)cc1 |
| InChI | InChI=1S/C32H40N6O4S/c1-5-8-19-33-32(40)37-43(41,42)27-14-10-9-13-25(27)24-17-15-23(16-18-24)21-38-28(11-6-2)36-30-22(4)26(20-34-31(30)38)35-29(39)12-7-3/h9-10,13-18,20H,5-8,11-12,19,21H2,1-4H3,(H,35,39)(H2,33,37,40) |
| InChIKey | ARDOFRQYQZJOFJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|