About 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine
1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine (PubChem CID 19754145) has the molecular formula C13H17N4S+
and a molecular weight of 261.37 g/mol. Its IUPAC name is 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine |
| PubChem CID | 19754145 |
| Molecular Formula | C13H17N4S+ |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine |
| SMILES | CSc1ccc(Nc2cc(C)[n+](C)c(N)n2)cc1 |
| InChI | InChI=1S/C13H16N4S/c1-9-8-12(16-13(14)17(9)2)15-10-4-6-11(18-3)7-5-10/h4-8H,1-3H3,(H2,14,15,16)/p+1 |
| InChIKey | XQLAZLKGLUFLFU-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine?
The IUPAC name of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine (CID 19754145) is 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine.
What is the SMILES notation for 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine?
The canonical SMILES for 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine is CSc1ccc(Nc2cc(C)[n+](C)c(N)n2)cc1.
What is the InChIKey of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine?
The InChIKey is XQLAZLKGLUFLFU-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H16N4S/c1-9-8-12(16-13(14)17(9)2)15-10-4-6-11(18-3)7-5-10/h4-8H,1-3H3,(H2,14,15,16)/p+1.
What are the key properties of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine?
1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine has a molecular weight of 261.37 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyrimidin-1-ium-2,4-diamine is sourced from PubChem (CID 19754145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).