C13H16N4 — CID 19754221
2-N,4-N,6-trimethyl-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 19754221) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-N,4-N,6-trimethyl-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N,6-trimethyl-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 19754221 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-N,4-N,6-trimethyl-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(C)cc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C13H16N4/c1-10-9-12(16-13(14-2)15-10)17(3)11-7-5-4-6-8-11/h4-9H,1-3H3,(H,14,15,16) |
| InChIKey | COTRQOFGHXVSRB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |