N-methylsulfonylsulfamoyl chloride

CH4ClNO4S2 — CID 19755022

IUPACN-methylsulfonylsulfamoyl chloride
SMILESCS(=O)(=O)NS(=O)(=O)Cl
InChIInChI=1S/CH4ClNO4S2/c1-8(4,5)3-9(2,6)7/h3H,1H3
InChIKeyCUDAMFBGWWPCPU-UHFFFAOYSA-N
MW193.63 g/mol
LogP-0.98
Rot. Bonds2

About N-methylsulfonylsulfamoyl chloride

N-methylsulfonylsulfamoyl chloride (PubChem CID 19755022) has the molecular formula CH4ClNO4S2 and a molecular weight of 193.63 g/mol. Its IUPAC name is N-methylsulfonylsulfamoyl chloride.

Molecular Properties

Compound NameN-methylsulfonylsulfamoyl chloride
PubChem CID19755022
Molecular FormulaCH4ClNO4S2
Molecular Weight193.63 g/mol
Exact Mass192.93
IUPAC NameN-methylsulfonylsulfamoyl chloride
SMILESCS(=O)(=O)NS(=O)(=O)Cl
InChIInChI=1S/CH4ClNO4S2/c1-8(4,5)3-9(2,6)7/h3H,1H3
InChIKeyCUDAMFBGWWPCPU-UHFFFAOYSA-N
XLogP-0.98
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.63
LogP ≤ 5-0.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze N-methylsulfonylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methylsulfonylsulfamoyl chloride?
The IUPAC name of N-methylsulfonylsulfamoyl chloride (CID 19755022) is N-methylsulfonylsulfamoyl chloride.
What is the SMILES notation for N-methylsulfonylsulfamoyl chloride?
The canonical SMILES for N-methylsulfonylsulfamoyl chloride is CS(=O)(=O)NS(=O)(=O)Cl.
What is the InChIKey of N-methylsulfonylsulfamoyl chloride?
The InChIKey is CUDAMFBGWWPCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4ClNO4S2/c1-8(4,5)3-9(2,6)7/h3H,1H3.
What are the key properties of N-methylsulfonylsulfamoyl chloride?
N-methylsulfonylsulfamoyl chloride has a molecular weight of 193.63 g/mol, XLogP of -0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylsulfonylsulfamoyl chloride is sourced from PubChem (CID 19755022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).