About 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene
2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene (PubChem CID 19755832) has the molecular formula C21H34O2
and a molecular weight of 318.50 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene.
Molecular Properties
| Compound Name | 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene |
| PubChem CID | 19755832 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene |
| SMILES | CC(C)CC(O)CC(C)C.CO.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H10.C9H20O.CH4O/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-7(2)5-9(10)6-8(3)4;1-2/h2-8H,1H3;7-10H,5-6H2,1-4H3;2H,1H3 |
| InChIKey | FYHMUZFHMIWXIO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene?
The IUPAC name of 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene (CID 19755832) is 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene.
What is the SMILES notation for 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene?
The canonical SMILES for 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene is CC(C)CC(O)CC(C)C.CO.Cc1ccc2ccccc2c1.
What is the InChIKey of 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene?
The InChIKey is FYHMUZFHMIWXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C9H20O.CH4O/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-7(2)5-9(10)6-8(3)4;1-2/h2-8H,1H3;7-10H,5-6H2,1-4H3;2H,1H3.
What are the key properties of 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene?
2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene has a molecular weight of 318.50 g/mol, XLogP of 5.20, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptan-4-ol;methanol;2-methylnaphthalene is sourced from PubChem (CID 19755832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).