C13H18O6 — CID 19755850
[4-(1,3-dioxolan-2-ylmethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 19755850) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-ylmethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [4-(1,3-dioxolan-2-ylmethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 19755850 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [4-(1,3-dioxolan-2-ylmethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CC(=O)OC1CC2OC(=O)CC2C1CC1OCCO1 |
| InChI | InChI=1S/C13H18O6/c1-7(14)18-10-6-11-8(4-12(15)19-11)9(10)5-13-16-2-3-17-13/h8-11,13H,2-6H2,1H3 |
| InChIKey | IZSMPAVLHAXPMW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |