About spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile
spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile (PubChem CID 19756098) has the molecular formula C16H11N
and a molecular weight of 217.27 g/mol. Its IUPAC name is spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile.
Molecular Properties
| Compound Name | spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile |
| PubChem CID | 19756098 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile |
| SMILES | N#CC1CC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C16H11N/c17-10-11-9-16(11)14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,11H,9H2 |
| InChIKey | JYEDMBDHXSCOIO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile?
The IUPAC name of spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile (CID 19756098) is spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile.
What is the SMILES notation for spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile?
The canonical SMILES for spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile is N#CC1CC12c1ccccc1-c1ccccc12.
What is the InChIKey of spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile?
The InChIKey is JYEDMBDHXSCOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N/c17-10-11-9-16(11)14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,11H,9H2.
What are the key properties of spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile?
spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile has a molecular weight of 217.27 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclopropane-2,9'-fluorene]-1-carbonitrile is sourced from PubChem (CID 19756098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).