C22H21FO3 — CID 19756611
2-[3-[(7-fluoronaphthalen-2-yl)methoxy]phenyl]pent-4-ene-1,3-diol (PubChem CID 19756611) has the molecular formula C22H21FO3 and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[3-[(7-fluoronaphthalen-2-yl)methoxy]phenyl]pent-4-ene-1,3-diol.
| Compound Name | 2-[3-[(7-fluoronaphthalen-2-yl)methoxy]phenyl]pent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 19756611 |
| Molecular Formula | C22H21FO3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[3-[(7-fluoronaphthalen-2-yl)methoxy]phenyl]pent-4-ene-1,3-diol |
| SMILES | C=CC(O)C(CO)c1cccc(OCc2ccc3ccc(F)cc3c2)c1 |
| InChI | InChI=1S/C22H21FO3/c1-2-22(25)21(13-24)17-4-3-5-20(12-17)26-14-15-6-7-16-8-9-19(23)11-18(16)10-15/h2-12,21-22,24-25H,1,13-14H2 |
| InChIKey | SMUIIJCKZLSVDJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|