About N-propylpropan-1-amine;N-propylprop-2-enamide
N-propylpropan-1-amine;N-propylprop-2-enamide (PubChem CID 19756679) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is N-propylpropan-1-amine;N-propylprop-2-enamide.
Molecular Properties
| Compound Name | N-propylpropan-1-amine;N-propylprop-2-enamide |
| PubChem CID | 19756679 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-propylpropan-1-amine;N-propylprop-2-enamide |
| SMILES | C=CC(=O)NCCC.CCCNCCC |
| InChI | InChI=1S/C6H11NO.C6H15N/c1-3-5-7-6(8)4-2;1-3-5-7-6-4-2/h4H,2-3,5H2,1H3,(H,7,8);7H,3-6H2,1-2H3 |
| InChIKey | KTJDDMYBTPWRRX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-propylpropan-1-amine;N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylpropan-1-amine;N-propylprop-2-enamide?
The IUPAC name of N-propylpropan-1-amine;N-propylprop-2-enamide (CID 19756679) is N-propylpropan-1-amine;N-propylprop-2-enamide.
What is the SMILES notation for N-propylpropan-1-amine;N-propylprop-2-enamide?
The canonical SMILES for N-propylpropan-1-amine;N-propylprop-2-enamide is C=CC(=O)NCCC.CCCNCCC.
What is the InChIKey of N-propylpropan-1-amine;N-propylprop-2-enamide?
The InChIKey is KTJDDMYBTPWRRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C6H15N/c1-3-5-7-6(8)4-2;1-3-5-7-6-4-2/h4H,2-3,5H2,1H3,(H,7,8);7H,3-6H2,1-2H3.
What are the key properties of N-propylpropan-1-amine;N-propylprop-2-enamide?
N-propylpropan-1-amine;N-propylprop-2-enamide has a molecular weight of 214.35 g/mol, XLogP of 2.09, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylpropan-1-amine;N-propylprop-2-enamide is sourced from PubChem (CID 19756679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).