C18H20N2O3 — CID 19756746
1,2-diisocyanato-3-methylbenzene;3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 19756746) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1,2-diisocyanato-3-methylbenzene;3,5,5-trimethylcyclohex-2-en-1-one.
| Compound Name | 1,2-diisocyanato-3-methylbenzene;3,5,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 19756746 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1,2-diisocyanato-3-methylbenzene;3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)C1.Cc1cccc(N=C=O)c1N=C=O |
| InChI | InChI=1S/C9H6N2O2.C9H14O/c1-7-3-2-4-8(10-5-12)9(7)11-6-13;1-7-4-8(10)6-9(2,3)5-7/h2-4H,1H3;4H,5-6H2,1-3H3 |
| InChIKey | DWMFSOOUIPYAHY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|