About (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid
(3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid (PubChem CID 19756907) has the molecular formula C4H9NO7P2
and a molecular weight of 245.06 g/mol. Its IUPAC name is (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid.
Molecular Properties
| Compound Name | (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid |
| PubChem CID | 19756907 |
| Molecular Formula | C4H9NO7P2 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid |
| SMILES | CC1=NOC(P(=O)(O)O)(P(=O)(O)O)C1 |
| InChI | InChI=1S/C4H9NO7P2/c1-3-2-4(12-5-3,13(6,7)8)14(9,10)11/h2H2,1H3,(H2,6,7,8)(H2,9,10,11) |
| InChIKey | MNDJZLMNWJYBMM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid?
The IUPAC name of (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid (CID 19756907) is (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid.
What is the SMILES notation for (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid?
The canonical SMILES for (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid is CC1=NOC(P(=O)(O)O)(P(=O)(O)O)C1.
What is the InChIKey of (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid?
The InChIKey is MNDJZLMNWJYBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO7P2/c1-3-2-4(12-5-3,13(6,7)8)14(9,10)11/h2H2,1H3,(H2,6,7,8)(H2,9,10,11).
What are the key properties of (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid?
(3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid has a molecular weight of 245.06 g/mol, XLogP of -0.21, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-phosphono-4H-1,2-oxazol-5-yl)phosphonic acid is sourced from PubChem (CID 19756907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).