C27H32O12 — CID 19757167
ethyl 4-[5-(4-ethoxycarbonyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 19757167) has the molecular formula C27H32O12 and a molecular weight of 548.54 g/mol. Its IUPAC name is ethyl 4-[5-(4-ethoxycarbonyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | ethyl 4-[5-(4-ethoxycarbonyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 19757167 |
| Molecular Formula | C27H32O12 |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | ethyl 4-[5-(4-ethoxycarbonyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(OC)C(=O)C(CCCCCC2=C(OC)C(=O)C(C(=O)OCC)=C(OC)C2=O)=C(OC)C1=O |
| InChI | InChI=1S/C27H32O12/c1-7-38-26(32)16-20(30)22(34-3)14(18(28)24(16)36-5)12-10-9-11-13-15-19(29)25(37-6)17(27(33)39-8-2)21(31)23(15)35-4/h7-13H2,1-6H3 |
| InChIKey | CTNCEJHVKOPHFH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|