C21H24O8 — CID 19757170
3-[4-(2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 19757170) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is 3-[4-(2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-[4-(2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 19757170 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-[4-(2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(OC)=C(CCCC(C)C2=C(OC)C(=O)C=C(OC)C2=O)C1=O |
| InChI | InChI=1S/C21H24O8/c1-11(17-19(25)16(27-3)10-14(23)21(17)29-5)7-6-8-12-18(24)15(26-2)9-13(22)20(12)28-4/h9-11H,6-8H2,1-5H3 |
| InChIKey | FFDJHHIEIRFNOQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|