About 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene
1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene (PubChem CID 19757192) has the molecular formula C21H32O6
and a molecular weight of 380.48 g/mol. Its IUPAC name is 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene.
Molecular Properties
| Compound Name | 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene |
| PubChem CID | 19757192 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene |
| SMILES | CCCCC#CCCCc1c(OC)c(OCOC)cc(OC)c1OCOC |
| InChI | InChI=1S/C21H32O6/c1-6-7-8-9-10-11-12-13-17-20(25-5)19(26-15-22-2)14-18(24-4)21(17)27-16-23-3/h14H,6-8,11-13,15-16H2,1-5H3 |
| InChIKey | PTKUCQPUWZPCSW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene?
The IUPAC name of 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene (CID 19757192) is 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene.
What is the SMILES notation for 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene?
The canonical SMILES for 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene is CCCCC#CCCCc1c(OC)c(OCOC)cc(OC)c1OCOC.
What is the InChIKey of 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene?
The InChIKey is PTKUCQPUWZPCSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O6/c1-6-7-8-9-10-11-12-13-17-20(25-5)19(26-15-22-2)14-18(24-4)21(17)27-16-23-3/h14H,6-8,11-13,15-16H2,1-5H3.
What are the key properties of 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene?
1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene has a molecular weight of 380.48 g/mol, XLogP of 4.19, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethoxy-2,5-bis(methoxymethoxy)-3-non-4-ynylbenzene is sourced from PubChem (CID 19757192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).