C28H36O10 — CID 19757214
ethyl 4-[5-(4-butyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 19757214) has the molecular formula C28H36O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is ethyl 4-[5-(4-butyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | ethyl 4-[5-(4-butyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 19757214 |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | ethyl 4-[5-(4-butyl-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-dien-1-yl)pentyl]-2,5-dimethoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCCCC1=C(OC)C(=O)C(CCCCCC2=C(OC)C(=O)C(C(=O)OCC)=C(OC)C2=O)=C(OC)C1=O |
| InChI | InChI=1S/C28H36O10/c1-7-9-13-16-20(29)25(35-4)17(21(30)24(16)34-3)14-11-10-12-15-18-22(31)27(37-6)19(28(33)38-8-2)23(32)26(18)36-5/h7-15H2,1-6H3 |
| InChIKey | XWHCMCFXKJRRTO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|