About 2,5-diethyl-2,3-dihydro-1-benzofuran
2,5-diethyl-2,3-dihydro-1-benzofuran (PubChem CID 19757400) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,5-diethyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 2,5-diethyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 19757400 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2,5-diethyl-2,3-dihydro-1-benzofuran |
| SMILES | CCc1ccc2c(c1)CC(CC)O2 |
| InChI | InChI=1S/C12H16O/c1-3-9-5-6-12-10(7-9)8-11(4-2)13-12/h5-7,11H,3-4,8H2,1-2H3 |
| InChIKey | ONGIOQUTRUCWMS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-diethyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 2,5-diethyl-2,3-dihydro-1-benzofuran (CID 19757400) is 2,5-diethyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2,5-diethyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2,5-diethyl-2,3-dihydro-1-benzofuran is CCc1ccc2c(c1)CC(CC)O2.
What is the InChIKey of 2,5-diethyl-2,3-dihydro-1-benzofuran?
The InChIKey is ONGIOQUTRUCWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-3-9-5-6-12-10(7-9)8-11(4-2)13-12/h5-7,11H,3-4,8H2,1-2H3.
What are the key properties of 2,5-diethyl-2,3-dihydro-1-benzofuran?
2,5-diethyl-2,3-dihydro-1-benzofuran has a molecular weight of 176.26 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 19757400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).