About CID 19757569
CID 19757569 (PubChem CID 19757569) has the molecular formula C31H40FOSSi
and a molecular weight of 507.81 g/mol.
Molecular Properties
| Compound Name | CID 19757569 |
| PubChem CID | 19757569 |
| Molecular Formula | C31H40FOSSi |
| Molecular Weight | 507.81 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | — |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OC(C)([Si])C(C)CCCCC)c(F)c3)s2)cc1 |
| InChI | InChI=1S/C31H40FOSSi/c1-5-7-9-11-13-24-14-16-25(17-15-24)29-20-21-30(34-29)26-18-19-28(27(32)22-26)33-31(4,35)23(3)12-10-8-6-2/h14-23H,5-13H2,1-4H3 |
| InChIKey | HWLSEMGCIARKSF-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.81 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19757569 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19757569?
The IUPAC name of CID 19757569 (CID 19757569) is not available.
What is the SMILES notation for CID 19757569?
The canonical SMILES for CID 19757569 is CCCCCCc1ccc(-c2ccc(-c3ccc(OC(C)([Si])C(C)CCCCC)c(F)c3)s2)cc1.
What is the InChIKey of CID 19757569?
The InChIKey is HWLSEMGCIARKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H40FOSSi/c1-5-7-9-11-13-24-14-16-25(17-15-24)29-20-21-30(34-29)26-18-19-28(27(32)22-26)33-31(4,35)23(3)12-10-8-6-2/h14-23H,5-13H2,1-4H3.
What are the key properties of CID 19757569?
CID 19757569 has a molecular weight of 507.81 g/mol, XLogP of 9.82, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19757569 is sourced from PubChem (CID 19757569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).