About 6-azido-7H-purin-2-amine;pyrrolidin-2-one
6-azido-7H-purin-2-amine;pyrrolidin-2-one (PubChem CID 19757679) has the molecular formula C9H11N9O
and a molecular weight of 261.25 g/mol. Its IUPAC name is 6-azido-7H-purin-2-amine;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 6-azido-7H-purin-2-amine;pyrrolidin-2-one |
| PubChem CID | 19757679 |
| Molecular Formula | C9H11N9O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-azido-7H-purin-2-amine;pyrrolidin-2-one |
| SMILES | O=C1CCCN1.[N-]=[N+]=Nc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C5H4N8.C4H7NO/c6-5-10-3-2(8-1-9-3)4(11-5)12-13-7;6-4-2-1-3-5-4/h1H,(H3,6,8,9,10,11);1-3H2,(H,5,6) |
| InChIKey | WDGKNEFLDRTGKO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-7H-purin-2-amine;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-7H-purin-2-amine;pyrrolidin-2-one?
The IUPAC name of 6-azido-7H-purin-2-amine;pyrrolidin-2-one (CID 19757679) is 6-azido-7H-purin-2-amine;pyrrolidin-2-one.
What is the SMILES notation for 6-azido-7H-purin-2-amine;pyrrolidin-2-one?
The canonical SMILES for 6-azido-7H-purin-2-amine;pyrrolidin-2-one is O=C1CCCN1.[N-]=[N+]=Nc1nc(N)nc2nc[nH]c12.
What is the InChIKey of 6-azido-7H-purin-2-amine;pyrrolidin-2-one?
The InChIKey is WDGKNEFLDRTGKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N8.C4H7NO/c6-5-10-3-2(8-1-9-3)4(11-5)12-13-7;6-4-2-1-3-5-4/h1H,(H3,6,8,9,10,11);1-3H2,(H,5,6).
What are the key properties of 6-azido-7H-purin-2-amine;pyrrolidin-2-one?
6-azido-7H-purin-2-amine;pyrrolidin-2-one has a molecular weight of 261.25 g/mol, XLogP of 0.77, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-7H-purin-2-amine;pyrrolidin-2-one is sourced from PubChem (CID 19757679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).