About N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide
N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide (PubChem CID 19758115) has the molecular formula C18H29NO3Si
and a molecular weight of 335.52 g/mol. Its IUPAC name is N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide |
| PubChem CID | 19758115 |
| Molecular Formula | C18H29NO3Si |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCC[Si](OCC)(OCC)c1ccccc1 |
| InChI | InChI=1S/C18H29NO3Si/c1-6-21-23(22-7-2,17-12-9-8-10-13-17)15-11-14-19(5)18(20)16(3)4/h8-10,12-13H,3,6-7,11,14-15H2,1-2,4-5H3 |
| InChIKey | RSAPPKQOTSLNET-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide?
The IUPAC name of N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide (CID 19758115) is N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide.
What is the SMILES notation for N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide?
The canonical SMILES for N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide is C=C(C)C(=O)N(C)CCC[Si](OCC)(OCC)c1ccccc1.
What is the InChIKey of N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide?
The InChIKey is RSAPPKQOTSLNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO3Si/c1-6-21-23(22-7-2,17-12-9-8-10-13-17)15-11-14-19(5)18(20)16(3)4/h8-10,12-13H,3,6-7,11,14-15H2,1-2,4-5H3.
What are the key properties of N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide?
N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide has a molecular weight of 335.52 g/mol, XLogP of 2.83, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[diethoxy(phenyl)silyl]propyl]-N,2-dimethylprop-2-enamide is sourced from PubChem (CID 19758115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).