About 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one
2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one (PubChem CID 19758212) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one |
| PubChem CID | 19758212 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one |
| SMILES | O=C1C=CNC(O)N1 |
| InChI | InChI=1S/C4H6N2O2/c7-3-1-2-5-4(8)6-3/h1-2,4-5,8H,(H,6,7) |
| InChIKey | YCELVGCIWLNMRG-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one?
The IUPAC name of 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one (CID 19758212) is 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one.
What is the SMILES notation for 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one?
The canonical SMILES for 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one is O=C1C=CNC(O)N1.
What is the InChIKey of 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one?
The InChIKey is YCELVGCIWLNMRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c7-3-1-2-5-4(8)6-3/h1-2,4-5,8H,(H,6,7).
What are the key properties of 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one?
2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one has a molecular weight of 114.10 g/mol, XLogP of -1.50, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,3-dihydro-1H-pyrimidin-4-one is sourced from PubChem (CID 19758212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).