About N-ethylethanamine;3-methylchromen-2-one
N-ethylethanamine;3-methylchromen-2-one (PubChem CID 19758433) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-ethylethanamine;3-methylchromen-2-one.
Molecular Properties
| Compound Name | N-ethylethanamine;3-methylchromen-2-one |
| PubChem CID | 19758433 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-ethylethanamine;3-methylchromen-2-one |
| SMILES | CCNCC.Cc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C10H8O2.C4H11N/c1-7-6-8-4-2-3-5-9(8)12-10(7)11;1-3-5-4-2/h2-6H,1H3;5H,3-4H2,1-2H3 |
| InChIKey | PWKRILGVIIBPRK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;3-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;3-methylchromen-2-one?
The IUPAC name of N-ethylethanamine;3-methylchromen-2-one (CID 19758433) is N-ethylethanamine;3-methylchromen-2-one.
What is the SMILES notation for N-ethylethanamine;3-methylchromen-2-one?
The canonical SMILES for N-ethylethanamine;3-methylchromen-2-one is CCNCC.Cc1cc2ccccc2oc1=O.
What is the InChIKey of N-ethylethanamine;3-methylchromen-2-one?
The InChIKey is PWKRILGVIIBPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C4H11N/c1-7-6-8-4-2-3-5-9(8)12-10(7)11;1-3-5-4-2/h2-6H,1H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;3-methylchromen-2-one?
N-ethylethanamine;3-methylchromen-2-one has a molecular weight of 233.31 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;3-methylchromen-2-one is sourced from PubChem (CID 19758433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).