About sodium;sulfuric acid;sulfate
sodium;sulfuric acid;sulfate (PubChem CID 19758473) has the molecular formula H2NaO8S2-
and a molecular weight of 217.13 g/mol. Its IUPAC name is sodium;sulfuric acid;sulfate.
Molecular Properties
| Compound Name | sodium;sulfuric acid;sulfate |
| PubChem CID | 19758473 |
| Molecular Formula | H2NaO8S2- |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 216.91 |
| IUPAC Name | sodium;sulfuric acid;sulfate |
| SMILES | O=S(=O)(O)O.O=S(=O)([O-])[O-].[Na+] |
| InChI | InChI=1S/Na.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+1;;/p-2 |
| InChIKey | LNDCCSBWZAQAAW-UHFFFAOYSA-L |
| XLogP | -4.99 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;sulfuric acid;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;sulfuric acid;sulfate?
The IUPAC name of sodium;sulfuric acid;sulfate (CID 19758473) is sodium;sulfuric acid;sulfate.
What is the SMILES notation for sodium;sulfuric acid;sulfate?
The canonical SMILES for sodium;sulfuric acid;sulfate is O=S(=O)(O)O.O=S(=O)([O-])[O-].[Na+].
What is the InChIKey of sodium;sulfuric acid;sulfate?
The InChIKey is LNDCCSBWZAQAAW-UHFFFAOYSA-L. The full InChI is InChI=1S/Na.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+1;;/p-2.
What are the key properties of sodium;sulfuric acid;sulfate?
sodium;sulfuric acid;sulfate has a molecular weight of 217.13 g/mol, XLogP of -4.99, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;sulfuric acid;sulfate is sourced from PubChem (CID 19758473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).