About 2-piperidin-4-ylpyrazine
2-piperidin-4-ylpyrazine (PubChem CID 19758800) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-piperidin-4-ylpyrazine.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpyrazine |
| PubChem CID | 19758800 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-piperidin-4-ylpyrazine |
| SMILES | c1cnc(C2CCNCC2)cn1 |
| InChI | InChI=1S/C9H13N3/c1-3-10-4-2-8(1)9-7-11-5-6-12-9/h5-8,10H,1-4H2 |
| InChIKey | QQMDJOVPTLPHMB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-4-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpyrazine?
The IUPAC name of 2-piperidin-4-ylpyrazine (CID 19758800) is 2-piperidin-4-ylpyrazine.
What is the SMILES notation for 2-piperidin-4-ylpyrazine?
The canonical SMILES for 2-piperidin-4-ylpyrazine is c1cnc(C2CCNCC2)cn1.
What is the InChIKey of 2-piperidin-4-ylpyrazine?
The InChIKey is QQMDJOVPTLPHMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-3-10-4-2-8(1)9-7-11-5-6-12-9/h5-8,10H,1-4H2.
What are the key properties of 2-piperidin-4-ylpyrazine?
2-piperidin-4-ylpyrazine has a molecular weight of 163.22 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpyrazine is sourced from PubChem (CID 19758800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).