About 4-piperazin-1-ylbutanoic acid
4-piperazin-1-ylbutanoic acid (PubChem CID 19758953) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-piperazin-1-ylbutanoic acid.
Molecular Properties
| Compound Name | 4-piperazin-1-ylbutanoic acid |
| PubChem CID | 19758953 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 4-piperazin-1-ylbutanoic acid |
| SMILES | O=C(O)CCCN1CCNCC1 |
| InChI | InChI=1S/C8H16N2O2/c11-8(12)2-1-5-10-6-3-9-4-7-10/h9H,1-7H2,(H,11,12) |
| InChIKey | QNUAPDZZKKIKGU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperazin-1-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-ylbutanoic acid?
The IUPAC name of 4-piperazin-1-ylbutanoic acid (CID 19758953) is 4-piperazin-1-ylbutanoic acid.
What is the SMILES notation for 4-piperazin-1-ylbutanoic acid?
The canonical SMILES for 4-piperazin-1-ylbutanoic acid is O=C(O)CCCN1CCNCC1.
What is the InChIKey of 4-piperazin-1-ylbutanoic acid?
The InChIKey is QNUAPDZZKKIKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c11-8(12)2-1-5-10-6-3-9-4-7-10/h9H,1-7H2,(H,11,12).
What are the key properties of 4-piperazin-1-ylbutanoic acid?
4-piperazin-1-ylbutanoic acid has a molecular weight of 172.23 g/mol, XLogP of -0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylbutanoic acid is sourced from PubChem (CID 19758953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).