C14H19ClN3O5P — CID 19759700
N-[(6-chloro-2-ethoxycarbonyl-5-methyl-1H-benzimidazol-4-yl)methyl]-ethoxyphosphonamidic acid (PubChem CID 19759700) has the molecular formula C14H19ClN3O5P and a molecular weight of 375.75 g/mol. Its IUPAC name is N-[(6-chloro-2-ethoxycarbonyl-5-methyl-1H-benzimidazol-4-yl)methyl]-ethoxyphosphonamidic acid.
| Compound Name | N-[(6-chloro-2-ethoxycarbonyl-5-methyl-1H-benzimidazol-4-yl)methyl]-ethoxyphosphonamidic acid |
|---|---|
| PubChem CID | 19759700 |
| Molecular Formula | C14H19ClN3O5P |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[(6-chloro-2-ethoxycarbonyl-5-methyl-1H-benzimidazol-4-yl)methyl]-ethoxyphosphonamidic acid |
| SMILES | CCOC(=O)c1nc2c(CNP(=O)(O)OCC)c(C)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H19ClN3O5P/c1-4-22-14(19)13-17-11-6-10(15)8(3)9(12(11)18-13)7-16-24(20,21)23-5-2/h6H,4-5,7H2,1-3H3,(H,17,18)(H2,16,20,21) |
| InChIKey | SZAYOODCBAUABJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|