About methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate
methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate (PubChem CID 19759826) has the molecular formula C23H44O4Sn
and a molecular weight of 503.31 g/mol. Its IUPAC name is methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate |
| PubChem CID | 19759826 |
| Molecular Formula | C23H44O4Sn |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate |
| SMILES | CCCC[Sn](/C=C/C1CC(CC(=O)OC)OC(C)(C)O1)(CCCC)CCCC |
| InChI | InChI=1S/C11H17O4.3C4H9.Sn/c1-5-8-6-9(7-10(12)13-4)15-11(2,3)14-8;3*1-3-4-2;/h1,5,8-9H,6-7H2,2-4H3;3*1,3-4H2,2H3; |
| InChIKey | KZEVJKUXKYNHBQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate?
The IUPAC name of methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate (CID 19759826) is methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate.
What is the SMILES notation for methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate?
The canonical SMILES for methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate is CCCC[Sn](/C=C/C1CC(CC(=O)OC)OC(C)(C)O1)(CCCC)CCCC.
What is the InChIKey of methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate?
The InChIKey is KZEVJKUXKYNHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17O4.3C4H9.Sn/c1-5-8-6-9(7-10(12)13-4)15-11(2,3)14-8;3*1-3-4-2;/h1,5,8-9H,6-7H2,2-4H3;3*1,3-4H2,2H3;.
What are the key properties of methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate?
methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate has a molecular weight of 503.31 g/mol, XLogP of 6.40, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2,2-dimethyl-6-[(E)-2-tributylstannylethenyl]-1,3-dioxan-4-yl]acetate is sourced from PubChem (CID 19759826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).