C20H27ClO — CID 19759922
(4E,7E,10E,13E,16E)-icosa-4,7,10,13,16,19-hexaenoyl chloride (PubChem CID 19759922) has the molecular formula C20H27ClO and a molecular weight of 318.89 g/mol. Its IUPAC name is (4E,7E,10E,13E,16E)-icosa-4,7,10,13,16,19-hexaenoyl chloride.
| Compound Name | (4E,7E,10E,13E,16E)-icosa-4,7,10,13,16,19-hexaenoyl chloride |
|---|---|
| PubChem CID | 19759922 |
| Molecular Formula | C20H27ClO |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4E,7E,10E,13E,16E)-icosa-4,7,10,13,16,19-hexaenoyl chloride |
| SMILES | C=CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)Cl |
| InChI | InChI=1S/C20H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2,4-5,7-8,10-11,13-14,16-17H,1,3,6,9,12,15,18-19H2/b5-4+,8-7+,11-10+,14-13+,17-16+ |
| InChIKey | GYULIZOLNSQTTG-ZACMJQCDSA-N |
| XLogP | 6.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|