C47H76N8O3 — CID 19760320
2-[[4,6-bis[1-[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 19760320) has the molecular formula C47H76N8O3 and a molecular weight of 801.18 g/mol. Its IUPAC name is 2-[[4,6-bis[1-[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4,6-bis[1-[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 19760320 |
| Molecular Formula | C47H76N8O3 |
| Molecular Weight | 801.18 g/mol |
| Exact Mass | 800.60 |
| IUPAC Name | 2-[[4,6-bis[1-[2,2,6,6-tetramethyl-1-(1-phenylethoxy)piperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCCC(Nc1nc(NCCO)nc(NC(CCC)C2CC(C)(C)N(OC(C)c3ccccc3)C(C)(C)C2)n1)C1CC(C)(C)N(OC(C)c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C47H76N8O3/c1-13-21-39(37-29-44(5,6)54(45(7,8)30-37)57-33(3)35-23-17-15-18-24-35)49-42-51-41(48-27-28-56)52-43(53-42)50-40(22-14-2)38-31-46(9,10)55(47(11,12)32-38)58-34(4)36-25-19-16-20-26-36/h15-20,23-26,33-34,37-40,56H,13-14,21-22,27-32H2,1-12H3,(H3,48,49,50,51,52,53) |
| InChIKey | HBTJXBDBYCONLE-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.18 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |