C9H8N2O2 — CID 19760430
1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carbonitrile (PubChem CID 19760430) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carbonitrile.
| Compound Name | 1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 19760430 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carbonitrile |
| SMILES | N#CN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C9H8N2O2/c10-5-11-8(12)6-3-1-2-4-7(6)9(11)13/h1-2,6-7H,3-4H2 |
| InChIKey | LVWBPDALRPYQBI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|