About 3-hydroperoxy-3,4-dihydroisochromen-1-one
3-hydroperoxy-3,4-dihydroisochromen-1-one (PubChem CID 19760474) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 3-hydroperoxy-3,4-dihydroisochromen-1-one.
Molecular Properties
| Compound Name | 3-hydroperoxy-3,4-dihydroisochromen-1-one |
| PubChem CID | 19760474 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-hydroperoxy-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OC(OO)Cc2ccccc21 |
| InChI | InChI=1S/C9H8O4/c10-9-7-4-2-1-3-6(7)5-8(12-9)13-11/h1-4,8,11H,5H2 |
| InChIKey | LKJYODULJBQDAN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroperoxy-3,4-dihydroisochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroperoxy-3,4-dihydroisochromen-1-one?
The IUPAC name of 3-hydroperoxy-3,4-dihydroisochromen-1-one (CID 19760474) is 3-hydroperoxy-3,4-dihydroisochromen-1-one.
What is the SMILES notation for 3-hydroperoxy-3,4-dihydroisochromen-1-one?
The canonical SMILES for 3-hydroperoxy-3,4-dihydroisochromen-1-one is O=C1OC(OO)Cc2ccccc21.
What is the InChIKey of 3-hydroperoxy-3,4-dihydroisochromen-1-one?
The InChIKey is LKJYODULJBQDAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-9-7-4-2-1-3-6(7)5-8(12-9)13-11/h1-4,8,11H,5H2.
What are the key properties of 3-hydroperoxy-3,4-dihydroisochromen-1-one?
3-hydroperoxy-3,4-dihydroisochromen-1-one has a molecular weight of 180.16 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroperoxy-3,4-dihydroisochromen-1-one is sourced from PubChem (CID 19760474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).