About (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal
(E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal (PubChem CID 19760587) has the molecular formula C19H40O3Si2
and a molecular weight of 372.70 g/mol. Its IUPAC name is (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal.
Molecular Properties
| Compound Name | (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal |
| PubChem CID | 19760587 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-18(2,3)23(7,8)21-16-12-14-17(13-11-15-20)22-24(9,10)19(4,5)6/h11,13,15,17H,12,14,16H2,1-10H3/b13-11+ |
| InChIKey | SZBFMXJOUBKQSP-ACCUITESSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal?
The IUPAC name of (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal (CID 19760587) is (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal.
What is the SMILES notation for (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal?
The canonical SMILES for (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal is CC(C)(C)[Si](C)(C)OCCCC(/C=C/C=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal?
The InChIKey is SZBFMXJOUBKQSP-ACCUITESSA-N. The full InChI is InChI=1S/C19H40O3Si2/c1-18(2,3)23(7,8)21-16-12-14-17(13-11-15-20)22-24(9,10)19(4,5)6/h11,13,15,17H,12,14,16H2,1-10H3/b13-11+.
What are the key properties of (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal?
(E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal has a molecular weight of 372.70 g/mol, XLogP of 5.93, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-2-enal is sourced from PubChem (CID 19760587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).