About 2-dodecoxy-3,4-dimethylthiophene
2-dodecoxy-3,4-dimethylthiophene (PubChem CID 19760689) has the molecular formula C18H32OS
and a molecular weight of 296.52 g/mol. Its IUPAC name is 2-dodecoxy-3,4-dimethylthiophene.
Molecular Properties
| Compound Name | 2-dodecoxy-3,4-dimethylthiophene |
| PubChem CID | 19760689 |
| Molecular Formula | C18H32OS |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 2-dodecoxy-3,4-dimethylthiophene |
| SMILES | CCCCCCCCCCCCOc1scc(C)c1C |
| InChI | InChI=1S/C18H32OS/c1-4-5-6-7-8-9-10-11-12-13-14-19-18-17(3)16(2)15-20-18/h15H,4-14H2,1-3H3 |
| InChIKey | NWFHANWARLKWPZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecoxy-3,4-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecoxy-3,4-dimethylthiophene?
The IUPAC name of 2-dodecoxy-3,4-dimethylthiophene (CID 19760689) is 2-dodecoxy-3,4-dimethylthiophene.
What is the SMILES notation for 2-dodecoxy-3,4-dimethylthiophene?
The canonical SMILES for 2-dodecoxy-3,4-dimethylthiophene is CCCCCCCCCCCCOc1scc(C)c1C.
What is the InChIKey of 2-dodecoxy-3,4-dimethylthiophene?
The InChIKey is NWFHANWARLKWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32OS/c1-4-5-6-7-8-9-10-11-12-13-14-19-18-17(3)16(2)15-20-18/h15H,4-14H2,1-3H3.
What are the key properties of 2-dodecoxy-3,4-dimethylthiophene?
2-dodecoxy-3,4-dimethylthiophene has a molecular weight of 296.52 g/mol, XLogP of 6.66, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecoxy-3,4-dimethylthiophene is sourced from PubChem (CID 19760689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).