About 1-ethenyl-2,4-diisocyanatobenzene
1-ethenyl-2,4-diisocyanatobenzene (PubChem CID 19760769) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is 1-ethenyl-2,4-diisocyanatobenzene.
Molecular Properties
| Compound Name | 1-ethenyl-2,4-diisocyanatobenzene |
| PubChem CID | 19760769 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 1-ethenyl-2,4-diisocyanatobenzene |
| SMILES | C=Cc1ccc(N=C=O)cc1N=C=O |
| InChI | InChI=1S/C10H6N2O2/c1-2-8-3-4-9(11-6-13)5-10(8)12-7-14/h2-5H,1H2 |
| InChIKey | XMMJPIAXXNHCEB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2,4-diisocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,4-diisocyanatobenzene?
The IUPAC name of 1-ethenyl-2,4-diisocyanatobenzene (CID 19760769) is 1-ethenyl-2,4-diisocyanatobenzene.
What is the SMILES notation for 1-ethenyl-2,4-diisocyanatobenzene?
The canonical SMILES for 1-ethenyl-2,4-diisocyanatobenzene is C=Cc1ccc(N=C=O)cc1N=C=O.
What is the InChIKey of 1-ethenyl-2,4-diisocyanatobenzene?
The InChIKey is XMMJPIAXXNHCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c1-2-8-3-4-9(11-6-13)5-10(8)12-7-14/h2-5H,1H2.
What are the key properties of 1-ethenyl-2,4-diisocyanatobenzene?
1-ethenyl-2,4-diisocyanatobenzene has a molecular weight of 186.17 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,4-diisocyanatobenzene is sourced from PubChem (CID 19760769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).