About (E)-4,4,5-trifluoro-2-methylhex-2-enoate
(E)-4,4,5-trifluoro-2-methylhex-2-enoate (PubChem CID 19760792) has the molecular formula C7H8F3O2-
and a molecular weight of 181.13 g/mol. Its IUPAC name is (E)-4,4,5-trifluoro-2-methylhex-2-enoate.
Molecular Properties
| Compound Name | (E)-4,4,5-trifluoro-2-methylhex-2-enoate |
| PubChem CID | 19760792 |
| Molecular Formula | C7H8F3O2- |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (E)-4,4,5-trifluoro-2-methylhex-2-enoate |
| SMILES | C/C(=C\C(F)(F)C(C)F)C(=O)[O-] |
| InChI | InChI=1S/C7H9F3O2/c1-4(6(11)12)3-7(9,10)5(2)8/h3,5H,1-2H3,(H,11,12)/p-1/b4-3+ |
| InChIKey | SBWQGZULZIXJGF-ONEGZZNKSA-M |
| XLogP | 0.68 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4,5-trifluoro-2-methylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4,5-trifluoro-2-methylhex-2-enoate?
The IUPAC name of (E)-4,4,5-trifluoro-2-methylhex-2-enoate (CID 19760792) is (E)-4,4,5-trifluoro-2-methylhex-2-enoate.
What is the SMILES notation for (E)-4,4,5-trifluoro-2-methylhex-2-enoate?
The canonical SMILES for (E)-4,4,5-trifluoro-2-methylhex-2-enoate is C/C(=C\C(F)(F)C(C)F)C(=O)[O-].
What is the InChIKey of (E)-4,4,5-trifluoro-2-methylhex-2-enoate?
The InChIKey is SBWQGZULZIXJGF-ONEGZZNKSA-M. The full InChI is InChI=1S/C7H9F3O2/c1-4(6(11)12)3-7(9,10)5(2)8/h3,5H,1-2H3,(H,11,12)/p-1/b4-3+.
What are the key properties of (E)-4,4,5-trifluoro-2-methylhex-2-enoate?
(E)-4,4,5-trifluoro-2-methylhex-2-enoate has a molecular weight of 181.13 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4,5-trifluoro-2-methylhex-2-enoate is sourced from PubChem (CID 19760792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).