C21H24N4O2S — CID 19761106
N-[4-(1,6,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13-tetraen-3-yl)phenyl]methanesulfonamide (PubChem CID 19761106) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[4-(1,6,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13-tetraen-3-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(1,6,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13-tetraen-3-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 19761106 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[4-(1,6,14-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-7,9,11,13-tetraen-3-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C2CCN3c4ccccc4C4=NCCCN4C23)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-28(26,27)23-16-9-7-15(8-10-16)17-11-14-24-19-6-3-2-5-18(19)20-22-12-4-13-25(20)21(17)24/h2-3,5-10,17,21,23H,4,11-14H2,1H3 |
| InChIKey | LXQPCIJMLKZCIE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |