C21H22O3 — CID 19761524
3-[3-(naphthalen-2-ylmethoxy)phenyl]butane-1,3-diol (PubChem CID 19761524) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[3-(naphthalen-2-ylmethoxy)phenyl]butane-1,3-diol.
| Compound Name | 3-[3-(naphthalen-2-ylmethoxy)phenyl]butane-1,3-diol |
|---|---|
| PubChem CID | 19761524 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 3-[3-(naphthalen-2-ylmethoxy)phenyl]butane-1,3-diol |
| SMILES | CC(O)(CCO)c1cccc(OCc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C21H22O3/c1-21(23,11-12-22)19-7-4-8-20(14-19)24-15-16-9-10-17-5-2-3-6-18(17)13-16/h2-10,13-14,22-23H,11-12,15H2,1H3 |
| InChIKey | ZPGABLRGKRVNDG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |