C9H10F10O — CID 19761914
1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-propan-2-yloxypentane (PubChem CID 19761914) has the molecular formula C9H10F10O and a molecular weight of 324.16 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-propan-2-yloxypentane.
| Compound Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-propan-2-yloxypentane |
|---|---|
| PubChem CID | 19761914 |
| Molecular Formula | C9H10F10O |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-propan-2-yloxypentane |
| SMILES | CC(C)OC(C)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F10O/c1-4(2)20-5(3,8(14,15)16)6(10,11)7(12,13)9(17,18)19/h4H,1-3H3 |
| InChIKey | DERIYBRQKSQLDP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|