C12H15F11O — CID 19761925
2-ethoxy-1,1,1,2,3,4,5,5,6,6,6-undecafluoro-4-methyl-3-propan-2-ylhexane (PubChem CID 19761925) has the molecular formula C12H15F11O and a molecular weight of 384.23 g/mol. Its IUPAC name is 2-ethoxy-1,1,1,2,3,4,5,5,6,6,6-undecafluoro-4-methyl-3-propan-2-ylhexane.
| Compound Name | 2-ethoxy-1,1,1,2,3,4,5,5,6,6,6-undecafluoro-4-methyl-3-propan-2-ylhexane |
|---|---|
| PubChem CID | 19761925 |
| Molecular Formula | C12H15F11O |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-ethoxy-1,1,1,2,3,4,5,5,6,6,6-undecafluoro-4-methyl-3-propan-2-ylhexane |
| SMILES | CCOC(F)(C(F)(F)F)C(F)(C(C)C)C(C)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F11O/c1-5-24-10(17,12(21,22)23)8(14,6(2)3)7(4,13)9(15,16)11(18,19)20/h6H,5H2,1-4H3 |
| InChIKey | VCOOPDZOHHSMKD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|