C10H12F10O — CID 19761932
1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(2-methylpropoxy)pentane (PubChem CID 19761932) has the molecular formula C10H12F10O and a molecular weight of 338.19 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(2-methylpropoxy)pentane.
| Compound Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(2-methylpropoxy)pentane |
|---|---|
| PubChem CID | 19761932 |
| Molecular Formula | C10H12F10O |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(2-methylpropoxy)pentane |
| SMILES | CC(C)COC(C)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F10O/c1-5(2)4-21-6(3,9(15,16)17)7(11,12)8(13,14)10(18,19)20/h5H,4H2,1-3H3 |
| InChIKey | AFUFKJCWNKGRAZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|