C9H6F13N — CID 19761935
1,1,1,4,5,5,5-heptafluoro-N,N-dimethyl-2,4-bis(trifluoromethyl)pent-2-en-3-amine (PubChem CID 19761935) has the molecular formula C9H6F13N and a molecular weight of 375.13 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-N,N-dimethyl-2,4-bis(trifluoromethyl)pent-2-en-3-amine.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-N,N-dimethyl-2,4-bis(trifluoromethyl)pent-2-en-3-amine |
|---|---|
| PubChem CID | 19761935 |
| Molecular Formula | C9H6F13N |
| Molecular Weight | 375.13 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-N,N-dimethyl-2,4-bis(trifluoromethyl)pent-2-en-3-amine |
| SMILES | CN(C)C(=C(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F13N/c1-23(2)4(3(6(11,12)13)7(14,15)16)5(10,8(17,18)19)9(20,21)22/h1-2H3 |
| InChIKey | SPLCQARFGUIHRT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.13 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |